CAS 78260-42-1
:Pentacene, dimer
Description:
Pentacene, dimer (CAS 78260-42-1) is a polycyclic aromatic hydrocarbon that consists of two pentacene molecules linked together. This compound exhibits characteristics typical of pentacene derivatives, including strong absorption in the ultraviolet-visible region, which is indicative of its conjugated structure. The dimerization enhances its stability compared to monomeric pentacene, making it less prone to oxidation and degradation. Pentacene, dimer is known for its semiconducting properties, which are valuable in organic electronics, particularly in organic field-effect transistors (OFETs) and organic photovoltaic cells. The molecular structure contributes to its high charge carrier mobility, a desirable trait for electronic applications. Additionally, the dimer may exhibit unique optical and electronic properties due to the interactions between the two pentacene units, potentially leading to applications in advanced materials and devices. Overall, pentacene, dimer represents an important compound in the field of organic chemistry and materials science, with ongoing research into its properties and applications.
Formula:(C22H14)2
InChI:InChI=1S/C22H14/c1-2-6-16-10-20-14-22-12-18-8-4-3-7-17(18)11-21(22)13-19(20)9-15(16)5-1/h1-14H
InChI key:InChIKey=SLIUAWYAILUBJU-UHFFFAOYSA-N
SMILES:C12=C(C=C3C(=C1)C=C4C(=C3)C=CC=C4)C=C5C(=C2)C=CC=C5
Synonyms:- Pentacene, dimer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
