CAS 78265-13-1
:1,4-dimethoxynaphthalene-2-carboxylic acid
Description:
1,4-Dimethoxynaphthalene-2-carboxylic acid is an organic compound characterized by its naphthalene backbone substituted with two methoxy groups and a carboxylic acid functional group. This compound typically appears as a solid at room temperature and is soluble in organic solvents due to its hydrophobic naphthalene structure, while the carboxylic acid group can engage in hydrogen bonding, enhancing its solubility in polar solvents. The presence of the methoxy groups contributes to its electronic properties, potentially influencing its reactivity and interactions in chemical reactions. This compound may exhibit interesting properties such as fluorescence or photochemical activity, making it relevant in various applications, including organic synthesis and materials science. Additionally, its structural features may allow it to participate in intermolecular interactions, which can be significant in the formation of supramolecular assemblies or in biological systems. As with many organic compounds, safety precautions should be taken when handling it, and its environmental impact should be considered in any applications.
Formula:C13H12O4
InChI:InChI=1/C13H12O4/c1-16-11-7-10(13(14)15)12(17-2)9-6-4-3-5-8(9)11/h3-7H,1-2H3,(H,14,15)
SMILES:COc1cc(c(c2ccccc12)OC)C(=O)O
Synonyms:- 1,4-Dimethoxy-2-naphthoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
