CymitQuimica logo

CAS 78267-24-0

:

ethyl 4-chloro-5-formyl-2-(phenylamino)thiophene-3-carboxylate

Description:
Ethyl 4-chloro-5-formyl-2-(phenylamino)thiophene-3-carboxylate is a synthetic organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of a formyl group indicates that it can participate in further chemical reactions, such as condensation or reduction. The chloro substituent enhances its electrophilic character, making it useful in various chemical transformations. Additionally, the phenylamino group introduces an aromatic amine functionality, which can influence the compound's solubility and interaction with biological systems. Ethyl 4-chloro-5-formyl-2-(phenylamino)thiophene-3-carboxylate may exhibit interesting properties such as fluorescence or biological activity, making it a candidate for research in medicinal chemistry or materials science. Its specific characteristics, including melting point, solubility, and spectral properties, would typically be determined through experimental methods and can vary based on the conditions of synthesis and purification.
Formula:C14H12ClNO3S
InChI:InChI=1/C14H12ClNO3S/c1-2-19-14(18)11-12(15)10(8-17)20-13(11)16-9-6-4-3-5-7-9/h3-8,16H,2H2,1H3
SMILES:CCOC(=O)c1c(c(C=O)sc1Nc1ccccc1)Cl
Synonyms:
  • 3-Thiophenecarboxylic Acid, 4-Chloro-5-Formyl-2-(Phenylamino)-, Ethyl Ester
  • Ethyl 2-anilino-4-chloro-5-formylthiophene-3-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.