CAS 78273-26-4

5-Hydrazinyl-2-pyridinecarboxylic acid

Description:

5-Hydrazinyl-2-pyridinecarboxylic acid, with the CAS number 78273-26-4, is an organic compound characterized by the presence of a hydrazine functional group and a pyridine ring. This compound features a carboxylic acid group (-COOH) attached to the pyridine, which contributes to its acidic properties. The hydrazinyl group (-NH-NH2) is known for its reactivity, particularly in forming hydrazones and other derivatives, making this compound potentially useful in various synthetic applications. The presence of the pyridine ring imparts aromatic stability and can influence the compound's solubility and reactivity in different solvents. Additionally, the compound may exhibit biological activity, which is of interest in medicinal chemistry. Its structural features suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. As with many nitrogen-containing compounds, safety precautions should be taken when handling due to potential toxicity or reactivity.

Formula: C₆H₇N₃O₂

InChI: InChI=1S/C6H7N3O2/c7-9-4-1-2-5(6(10)11)8-3-4/h1-3,9H,7H2,(H,10,11)

InChI key: InChIKey=PWPODTNJDOITDE-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC=C(NN)C=N1

Synonyms:

• 5-Hydrazinyl-2-pyridinecarboxylic acid
• 2-Pyridinecarboxylic acid, 5-hydrazino-
• 2-Pyridinecarboxylic acid, 5-hydrazinyl-