CAS 78277-27-7
:Phenylmethyl 1H-indole-2-carboxylate
Description:
Phenylmethyl 1H-indole-2-carboxylate, with the CAS number 78277-27-7, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a phenylmethyl group (benzyl group) attached to the indole nitrogen, along with a carboxylate functional group at the 2-position of the indole ring. It is typically a white to off-white solid and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO), but may have limited solubility in water. The presence of the carboxylate group suggests potential for hydrogen bonding and reactivity, making it of interest in various chemical reactions, including esterification and amidation. Additionally, compounds with indole structures are often studied for their biological activities, including potential pharmaceutical applications. As with many organic compounds, handling should be done with care, observing appropriate safety protocols due to potential toxicity or reactivity.
Formula:C16H13NO2
InChI:InChI=1S/C16H13NO2/c18-16(19-11-12-6-2-1-3-7-12)15-10-13-8-4-5-9-14(13)17-15/h1-10,17H,11H2
InChI key:InChIKey=GBVAGZMJJSANDQ-UHFFFAOYSA-N
SMILES:C(OCC1=CC=CC=C1)(=O)C2=CC=3C(N2)=CC=CC3
Synonyms:- Phenylmethyl 1H-indole-2-carboxylate
- Benzyl indole-2-carboxylate
- Indole-2-carboxylic acid benzyl ester
- 1H-Indole-2-carboxylic acid, phenylmethyl ester
- 1H-Indole-2-carboxylic acid benzyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
