CAS 78295-91-7

6-fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid

Description:

6-Fluoro-4-oxo-7-(piperazin-1-yl)-1,4-dihydroquinoline-3-carboxylic acid is a synthetic compound belonging to the class of quinolines, which are bicyclic aromatic compounds known for their diverse biological activities. This particular compound features a fluorine atom at the 6-position and a piperazine moiety at the 7-position, contributing to its pharmacological properties. The presence of the carboxylic acid functional group enhances its solubility in polar solvents and may influence its interaction with biological targets. The compound is characterized by its potential antimicrobial and antiviral activities, making it of interest in medicinal chemistry. Its structure allows for various modifications, which can be explored to optimize its efficacy and reduce toxicity. Additionally, the compound's unique combination of functional groups may facilitate interactions with specific receptors or enzymes, further underscoring its relevance in drug development. As with many synthetic compounds, understanding its stability, reactivity, and biological profile is crucial for assessing its potential applications in therapeutic contexts.

Formula: C₁₄H₁₄FN₃O₃

InChI: InChI=1/C14H14FN3O3/c15-10-5-8-11(17-7-9(13(8)19)14(20)21)6-12(10)18-3-1-16-2-4-18/h5-7,16H,1-4H2,(H,17,19)(H,20,21)

SMILES: C1CN(CCN1)c1cc2c(cc1F)c(=O)c(c[nH]2)C(=O)O

Synonyms:

• 3-Quinolinecarboxylic acid, 6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-
• 3-Quinolinecarboxylic Acid, 6-Fluoro-4-Hydroxy-7-(1-Piperazinyl)-
• 6-Fluoro-4-Hydroxy-7-(Piperazin-1-Yl)Quinoline-3-Carboxylic Acid