CAS 783-95-9

2-chloro-6-methyl-5-nitro-4-(trifluoromethyl)pyridine-3-carbonitrile

Description:

2-Chloro-6-methyl-5-nitro-4-(trifluoromethyl)pyridine-3-carbonitrile, with the CAS number 783-95-9, is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features several functional groups, including a chloro group, a nitro group, a trifluoromethyl group, and a cyano group, contributing to its chemical reactivity and potential applications. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. The nitro group can serve as a site for reduction reactions, while the cyano group can participate in nucleophilic addition reactions. This compound is typically used in the synthesis of pharmaceuticals and agrochemicals due to its diverse reactivity. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Overall, 2-chloro-6-methyl-5-nitro-4-(trifluoromethyl)pyridine-3-carbonitrile is a valuable compound in organic synthesis and medicinal chemistry.

Formula: C₈H₃ClF₃N₃O₂

InChI: InChI=1/C8H3ClF3N3O2/c1-3-6(15(16)17)5(8(10,11)12)4(2-13)7(9)14-3/h1H3

SMILES: Cc1c(c(c(C#N)c(Cl)n1)C(F)(F)F)N(=O)=O

Synonyms:

• Nicotinonitrile, 2-chloro-6-methyl-5-nitro-4-(trifluoromethyl)-

2-chloro-6-methyl-5-nitro-4-(trifluoromethyl)nicotinonitrile

CAS: 783-95-9

2-chloro-6-methyl-5-nitro-4-(trifluoromethyl)nicotinonitrile

Purity: ≥95%

Molecular weight: 265.58g/mol

Ref: 54-PC32000