CAS 78302-26-8

4,4,5,5-tetradeuterio-2-[1-(2,6-dichlorophenoxy)ethyl]-1H-imidazole

Description:

4,4,5,5-Tetradeuterio-2-[1-(2,6-dichlorophenoxy)ethyl]-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of deuterium, a stable isotope of hydrogen, indicates that this compound has been isotopically labeled, which can be useful in various analytical and research applications, particularly in studies involving metabolic pathways or reaction mechanisms. The compound features a 2-(1-(2,6-dichlorophenoxy)ethyl) substituent, suggesting it has potential biological activity, possibly as a pharmaceutical agent. The dichlorophenoxy group indicates the presence of chlorine substituents on a phenyl ring, which can influence the compound's lipophilicity and biological interactions. Overall, this compound's unique structure and isotopic labeling make it a valuable tool in chemical research, particularly in the fields of medicinal chemistry and pharmacology. Its CAS number, 78302-26-8, provides a unique identifier for regulatory and safety information.

Formula: C₁₁H₈D₄Cl₂N₂O

InChI: InChI=1/C11H12Cl2N2O/c1-7(11-14-5-6-15-11)16-10-8(12)3-2-4-9(10)13/h2-4,7H,5-6H2,1H3,(H,14,15)/i5D2,6D2

SMILES: CC(C1=NC(C(N1)([2H])[2H])([2H])[2H])Oc1c(cccc1Cl)Cl

Lofexidine-d4

CAS: 78302-26-8

Formula: C₁₁H₈D₄Cl₂N₂O

Color and Shape: White To Off-White Solid

Molecular weight: 263.15

Ref: 4Z-L-206002