
CAS 78304-55-9
:Furo[2,3-d]pyrimidine, 6-(bromomethyl)-5,6-dihydro-2,4-dimethyl-, hydrobromide (1:1)
Description:
Furo[2,3-d]pyrimidine, 6-(bromomethyl)-5,6-dihydro-2,4-dimethyl-, hydrobromide (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both furan and pyrimidine rings. The presence of bromomethyl groups indicates that it has a bromine atom attached to a methyl group, enhancing its reactivity and potential for further chemical modifications. The dihydro form suggests that the compound has two additional hydrogen atoms, contributing to its stability and influencing its physical properties. The dimethyl substitutions at the 2 and 4 positions of the pyrimidine ring can affect the compound's electronic properties and steric hindrance, potentially impacting its biological activity. As a hydrobromide salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including pharmaceuticals and organic synthesis. Overall, this compound's structural features suggest potential utility in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C9H11BrN2O·BrH
InChI:InChI=1S/C9H11BrN2O.BrH/c1-5-8-3-7(4-10)13-9(8)12-6(2)11-5;/h7H,3-4H2,1-2H3;1H
InChI key:InChIKey=FIMYGNBKOXJSER-UHFFFAOYSA-N
SMILES:CC1=C2C(OC(CBr)C2)=NC(C)=N1.Br
Synonyms:- Furo[2,3-d]pyrimidine, 6-(bromomethyl)-5,6-dihydro-2,4-dimethyl-, hydrobromide (1:1)
- Furo[2,3-d]pyrimidine, 6-(bromomethyl)-5,6-dihydro-2,4-dimethyl-, monohydrobromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.