CymitQuimica logo

CAS 78304-56-0

:

6-(bromomethyl)-2,4-dimethyl-5,6-dihydrofuro[2,3-d]pyrimidine

Description:
6-(Bromomethyl)-2,4-dimethyl-5,6-dihydrofuro[2,3-d]pyrimidine is a heterocyclic organic compound characterized by its complex fused ring structure, which includes both furan and pyrimidine moieties. The presence of the bromomethyl group introduces a halogen substituent that can influence the compound's reactivity and potential applications in organic synthesis. The dimethyl groups contribute to the compound's steric properties and may affect its solubility and interaction with biological targets. This compound is likely to exhibit moderate to low solubility in polar solvents due to its hydrophobic regions, while the bromine atom can enhance its electrophilic character. Its unique structure may render it of interest in medicinal chemistry, particularly for the development of pharmaceuticals or agrochemicals. Additionally, the compound's stability and reactivity can be influenced by the presence of the dihydrofuro and pyrimidine rings, which may participate in various chemical reactions, including nucleophilic substitutions or cycloadditions. Overall, this compound represents a fascinating example of a multifunctional heterocycle with potential utility in various chemical applications.
Formula:C9H11BrN2O
InChI:InChI=1/C9H11BrN2O/c1-5-8-3-7(4-10)13-9(8)12-6(2)11-5/h7H,3-4H2,1-2H3
SMILES:Cc1c2CC(CBr)Oc2nc(C)n1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.