CAS 78316-08-2

7aH-imidazo[4,5-b]pyridine-7-carboxylic acid

Description:

7aH-imidazo[4,5-b]pyridine-7-carboxylic acid is a heterocyclic organic compound characterized by its imidazo and pyridine ring structures. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The imidazo[4,5-b]pyridine framework is known for its biological activity, making it of interest in medicinal chemistry and drug development. The presence of the carboxylic acid group enhances its solubility in polar solvents and may facilitate interactions with biological targets. Additionally, the compound's structure allows for various substitution patterns, which can influence its pharmacological properties. It may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, depending on the specific substituents and the context of its use. Overall, 7aH-imidazo[4,5-b]pyridine-7-carboxylic acid represents a versatile scaffold in organic synthesis and pharmaceutical research.

Formula: C₇H₅N₃O₂

InChI: InChI=1/C7H5N3O2/c11-7(12)4-1-2-8-6-5(4)9-3-10-6/h1-3,5H,(H,11,12)

SMILES: C1=C(C2C(=NC=N2)N=C1)C(=O)O

Synonyms:

• 3H-imidazo[4,5-b]pyridine-7-carboxylic acid

3H-IMIDAZO[4,5-B]PYRIDINE-7-CARBOXYLIC ACID

CAS: 78316-08-2

Formula: C₇H₅N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.1335

Ref: IN-DA0039C4

3H-Imidazo[4,5-b]pyridine-7-carboxylic acid

CAS: 78316-08-2

3H-Imidazo[4,5-b]pyridine-7-carboxylic acid

Molecular weight: 163.1335g/mol

Ref: 54-OR1021501

3H-Imidazo[4,5-b]pyridine-7-carboxylic acid

CAS: 78316-08-2

Purity: 95.0%

Molecular weight: 163.13600158691406

Ref: 10-F465211