CymitQuimica logo

CAS 783251-37-6

:

4-(2-Piperazinyl)phenol

Description:
4-(2-Piperazinyl)phenol, identified by its CAS number 783251-37-6, is a chemical compound characterized by the presence of a phenolic group substituted with a piperazine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The piperazine ring, known for its role in various pharmacological applications, enhances the compound's solubility and reactivity. 4-(2-Piperazinyl)phenol may display characteristics such as moderate to high polarity due to the hydroxyl group and the nitrogen atoms in the piperazine ring, which can participate in hydrogen bonding. This compound is of interest in medicinal chemistry, particularly for its potential use in drug development, as it may interact with biological targets, influencing various physiological processes. Its synthesis and characterization involve standard organic chemistry techniques, and it may be studied for its pharmacokinetic properties and therapeutic applications. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C10H14N2O
InChI:InChI=1/C10H14N2O/c13-9-3-1-8(2-4-9)10-7-11-5-6-12-10/h1-4,10-13H,5-7H2
SMILES:c1cc(ccc1C1CNCCN1)O
Synonyms:
  • Phenol, 4-(2-Piperazinyl)-
  • 4-(Piperazin-2-Yl)Phenol
  • 4-(2-Piperazinyl)phenol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.