CAS 783284-17-3

(1H-benzimidazol-2-ylmethoxy)acetic acid

Description:

(1H-benzimidazol-2-ylmethoxy)acetic acid, with the CAS number 783284-17-3, is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a methoxy group and an acetic acid functional group, contributing to its potential as a bioactive molecule. It is typically a white to off-white solid and is soluble in polar solvents, which may facilitate its use in various chemical reactions and applications. The presence of the benzimidazole moiety suggests potential pharmacological properties, as many benzimidazole derivatives are known for their biological activity, including antimicrobial and anti-inflammatory effects. The acetic acid group may enhance its solubility and reactivity, making it suitable for further chemical modifications. Overall, this compound's unique structure and functional groups position it as a candidate for research in medicinal chemistry and related fields.

Formula: C₁₀H₁₀N₂O₃

InChI: InChI=1/C10H10N2O3/c13-10(14)6-15-5-9-11-7-3-1-2-4-8(7)12-9/h1-4H,5-6H2,(H,11,12)(H,13,14)

SMILES: c1ccc2c(c1)nc(COCC(=O)O)[nH]2

Synonyms:

• 2-(1H-benzimidazol-2-ylmethoxy)acetic acid
• Acetic acid, 2-(1H-benzimidazol-2-ylmethoxy)-

2-((1H-Benzo[d]imidazol-2-yl)methoxy)acetic acid

CAS: 783284-17-3

2-((1H-Benzo[d]imidazol-2-yl)methoxy)acetic acid

Purity: 95%

Molecular weight: 206.2g/mol

Ref: 54-OR1064346