CAS 78329-81-4

2-(diethylamino)ethyl 3-amino-4-ethoxybenzoate

Description:

2-(Diethylamino)ethyl 3-amino-4-ethoxybenzoate, identified by its CAS number 78329-81-4, is an organic compound characterized by its complex structure, which includes an amino group, an ethoxy group, and a diethylamino moiety. This compound typically exhibits properties associated with both amines and esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups. It may serve as an intermediate in organic synthesis or as a pharmaceutical agent, given its structural features that can influence biological activity. The presence of the diethylamino group suggests potential for basicity, while the ethoxy and benzoate components may contribute to hydrophobic characteristics. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards in laboratory or industrial settings.

Formula: C₁₅H₂₄N₂O₃

InChI: InChI=1/C15H24N2O3/c1-4-17(5-2)9-10-20-15(18)12-7-8-14(19-6-3)13(16)11-12/h7-8,11H,4-6,9-10,16H2,1-3H3

SMILES: CCN(CC)CCOC(=O)c1ccc(c(c1)N)OCC

Proparacaine Impurity 4

CAS: 78329-81-4

Formula: C₁₅H₂₄N₂O₃

Color and Shape: Pale Yellow To Off-White Liquid

Molecular weight: 280.37

Ref: 4Z-P-305005