CAS 783324-41-4
:3-Buten-2-ol, 4-(2,6,6-trimethyl-2-cyclohexen-1-yl)-, 2-acetate, (3E)-
Description:
3-Buten-2-ol, 4-(2,6,6-trimethyl-2-cyclohexen-1-yl)-, 2-acetate, (3E)- is an organic compound characterized by its complex structure, which includes a butenol moiety and an acetate functional group. This compound features a double bond in the butenol segment, contributing to its reactivity and potential for isomerization. The presence of the 2,6,6-trimethyl-2-cyclohexen-1-yl group adds steric bulk and influences the compound's physical properties, such as boiling point and solubility. As an acetate, it is likely to exhibit moderate polarity, making it soluble in organic solvents while being less soluble in water. The compound may also possess interesting aromatic characteristics due to the cyclohexene ring, which can affect its fragrance and flavor profile, making it relevant in the fragrance and flavor industry. Additionally, its stereochemistry, indicated by the (3E) configuration, suggests specific spatial arrangements that can influence its biological activity and interactions with other molecules. Overall, this compound's unique structure and functional groups contribute to its potential applications in various fields, including organic synthesis and perfumery.
Formula:C15H24O2
InChI:InChI=1/C15H24O2/c1-11-7-6-10-15(4,5)14(11)9-8-12(2)17-13(3)16/h7-9,12,14H,6,10H2,1-5H3/b9-8+
InChI key:InChIKey=WHHAWKIPTSGTNC-CMDGGOBGNA-N
SMILES:C(=C/C(OC(C)=O)C)\C1C(C)(C)CCC=C1C
Synonyms:- 3-Buten-2-ol, 4-(2,6,6-trimethyl-2-cyclohexen-1-yl)-, acetate, (3E)-
- 3-Buten-2-ol, 4-(2,6,6-trimethyl-2-cyclohexen-1-yl)-, 2-acetate, (3E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
