CAS 783325-29-1
:1,1-Dimethylethyl (2R)-2-[(methylamino)methyl]-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl (2R)-2-[(methylamino)methyl]-1-piperidinecarboxylate, identified by its CAS number 783325-29-1, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a dimethyl group and a methylamino substituent, contributing to its unique structural and functional properties. It is typically classified as an amine due to the presence of the amino group, which can participate in various chemical reactions, including nucleophilic substitutions. The ester functional group in the carboxylate portion suggests potential reactivity in hydrolysis or transesterification reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its stereochemistry, indicated by the (2R) configuration, suggests specific spatial arrangements that can influence its interaction with biological targets. Overall, this compound's structural features and functional groups contribute to its potential applications in various fields, including drug development and synthetic chemistry.
Formula:C12H24N2O2
InChI:InChI=1S/C12H24N2O2/c1-12(2,3)16-11(15)14-8-6-5-7-10(14)9-13-4/h10,13H,5-9H2,1-4H3/t10-/m1/s1
InChI key:InChIKey=MDSFYYLVYHYPGW-SNVBAGLBSA-N
SMILES:C(NC)[C@@H]1N(C(OC(C)(C)C)=O)CCCC1
Synonyms:- 1-Piperidinecarboxylic acid, 2-[(methylamino)methyl]-, 1,1-dimethylethyl ester, (2R)-
- 1-N-BOC-2-N’-METHYL-AMINO PIPERIDINE
- 1-N-BOC-2-(N’-METHYL-AMINOMETHYL)PIPERIDINE
- 1,1-Dimethylethyl (2R)-2-[(methylamino)methyl]-1-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.