CAS 78338-68-8
:4-(4-Methoxyphenoxy)benzonitrile
Description:
4-(4-Methoxyphenoxy)benzonitrile, with the CAS number 78338-68-8, is an organic compound characterized by its aromatic structure, which includes a benzonitrile moiety and a methoxyphenoxy group. This compound typically exhibits a white to off-white crystalline appearance. It is known for its potential applications in various fields, including pharmaceuticals and materials science, due to its unique chemical properties. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Additionally, the nitrile functional group contributes to its polarity and can participate in various chemical reactions, such as nucleophilic additions. The compound's stability and reactivity can be influenced by factors such as temperature and pH. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, 4-(4-Methoxyphenoxy)benzonitrile is a compound of interest for further research and application development.
Formula:C14H11NO2
InChI:InChI=1S/C14H11NO2/c1-16-12-6-8-14(9-7-12)17-13-4-2-11(10-15)3-5-13/h2-9H,1H3
InChI key:InChIKey=IXNXINOPSYVXPM-UHFFFAOYSA-N
SMILES:O(C1=CC=C(C#N)C=C1)C2=CC=C(OC)C=C2
Synonyms:- 4-(4-Cyanophenoxy)methoxybenzene
- 4-(4-Methoxyphenoxy)benzonitrile
- 4-Cyano-4'-methoxydiphenyl ether
- Benzonitrile, 4-(4-methoxyphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.