CAS 78345-60-5

1-(Cyclohexylmethylamino)-2-propanol

Description:

1-(Cyclohexylmethylamino)-2-propanol, identified by its CAS number 78345-60-5, is an organic compound characterized by its amine and alcohol functional groups. This substance typically appears as a colorless to pale yellow liquid and is soluble in water and various organic solvents, which is indicative of its polar nature due to the presence of the hydroxyl (-OH) group. The cyclohexylmethylamino moiety contributes to its hydrophobic characteristics, influencing its interaction with biological systems. It is often studied for its potential applications in pharmaceuticals, particularly in the development of drugs that target the central nervous system. The compound's structure allows for hydrogen bonding, which can affect its reactivity and interaction with other molecules. Additionally, it may exhibit properties such as moderate volatility and stability under standard conditions, making it suitable for various chemical processes. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₂₁NO

InChI: InChI=1S/C10H21NO/c1-9(12)8-11(2)10-6-4-3-5-7-10/h9-10,12H,3-8H2,1-2H3

InChI key: InChIKey=AOYWMHSHNWYFCL-UHFFFAOYSA-N

SMILES: N(CC(C)O)(C)C1CCCCC1

Synonyms:

• 2-Propanol, 1-(cyclohexylmethylamino)-
• 1-[Cyclohexyl(methyl)amino]-2-propanol
• 1-(Cyclohexylmethylamino)-2-propanol