CymitQuimica logo

CAS 78364-19-9

:

2-(4-Chlorophenyl)-1,2-dihydro-1-oxo-4-isoquinolinecarboxylic acid

Description:
2-(4-Chlorophenyl)-1,2-dihydro-1-oxo-4-isoquinolinecarboxylic acid, with the CAS number 78364-19-9, is a chemical compound that belongs to the class of isoquinoline derivatives. This substance typically exhibits a complex structure characterized by a fused isoquinoline ring system and a carboxylic acid functional group. The presence of the 4-chlorophenyl group contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The compound may display various pharmacological effects, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C16H10ClNO3
InChI:InChI=1S/C16H10ClNO3/c17-10-5-7-11(8-6-10)18-9-14(16(20)21)12-3-1-2-4-13(12)15(18)19/h1-9H,(H,20,21)
InChI key:InChIKey=MSLLYIWIWOXVLZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(C(=O)N(C1)C3=CC=C(Cl)C=C3)=CC=CC2
Synonyms:
  • 2-(4-Chlorophenyl)-1-oxo-1,2-dihydroisoquinoline-4-carboxylic acid
  • 2-(4-Chloro-phenyl)-1-oxo-1,2-dihydro-isoquinoline-4-carboxylic acid
  • 2-(4-Chlorophenyl)-1-oxoisoquinoline-4-carboxylic acid
  • 2-(4-Chlorophenyl)-1,2-dihydro-1-oxo-4-isoquinolinecarboxylic acid
  • 4-Isoquinolinecarboxylic acid, 2-(4-chlorophenyl)-1,2-dihydro-1-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.