CymitQuimica logo

CAS 78381-94-9

:

3-fluoro-2-oxopropanal

Description:
3-Fluoro-2-oxopropanal, with the CAS number 78381-94-9, is an organic compound characterized by its functional groups, including a fluorine atom and a carbonyl group (aldehyde) adjacent to a ketone. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of both the aldehyde and ketone functionalities, which can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. The fluorine atom can influence the compound's polarity and reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Its molecular structure contributes to its unique properties, including potential applications in medicinal chemistry. As with many fluorinated compounds, it may exhibit distinct biological activities and environmental behaviors, necessitating careful handling and assessment of its safety profile. Overall, 3-fluoro-2-oxopropanal is a valuable compound in synthetic organic chemistry.
Formula:C3H3FO2
InChI:InChI=1/C3H3FO2/c4-1-3(6)2-5/h2H,1H2
SMILES:C(C(=O)C=O)F
Synonyms:
  • Propanal, 3-Fluoro-2-Oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.