CAS 78409-62-8

3,5-Dioxo-1,2,4-triazolidine-4-butanoic acid

Description:

3,5-Dioxo-1,2,4-triazolidine-4-butanoic acid, with the CAS number 78409-62-8, is a heterocyclic compound featuring a triazolidine ring. This compound is characterized by the presence of two carbonyl groups (dioxo) and a butanoic acid moiety, which contributes to its acidic properties. The triazolidine ring structure imparts unique reactivity, making it a potential candidate for various chemical transformations. It is typically synthesized through multi-step organic reactions involving the appropriate precursors. The compound may exhibit biological activity, which has led to interest in its potential applications in pharmaceuticals or agrochemicals. Its solubility and stability can vary depending on the solvent and environmental conditions, influencing its practical uses. As with many chemical substances, safety data should be consulted to understand its handling and toxicity. Overall, 3,5-Dioxo-1,2,4-triazolidine-4-butanoic acid represents a class of compounds that can be explored for diverse applications in chemistry and related fields.

Formula: C₆H₉N₃O₄

InChI: InChI=1S/C6H9N3O4/c10-4(11)2-1-3-9-5(12)7-8-6(9)13/h1-3H2,(H,7,12)(H,8,13)(H,10,11)

InChI key: InChIKey=AQURIHZWVLCBGN-UHFFFAOYSA-N

SMILES: C(CCC(O)=O)N1C(=O)NNC1=O

Synonyms:

• 1,2,4-Triazolidine-4-butanoic acid, 3,5-dioxo-
• 3,5-Dioxo-1,2,4-triazolidine-4-butanoic acid

4-(3,5-Dioxo-1,2,4-triazolidin-4-yl)butanoic acid

CAS: 78409-62-8

Versatile small molecule scaffold

Formula: C₆H₉N₃O₄

Purity: Min. 95%

Molecular weight: 187.15 g/mol

Ref: 3D-DDA40962