
CAS 784143-99-3
:2,3,4,9-Tetrahydro-1H-carbazole-5-carboxylic acid
Description:
2,3,4,9-Tetrahydro-1H-carbazole-5-carboxylic acid is a bicyclic compound characterized by its unique structure, which includes a carbazole core with a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its fused ring structure. It is likely to be a solid at room temperature, with moderate solubility in polar solvents, owing to the presence of the carboxylic acid group, which can engage in hydrogen bonding. The compound may display biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis often involves multi-step organic reactions, and it may serve as a precursor or intermediate in the production of more complex molecules. Additionally, its stability and reactivity can be influenced by the presence of substituents on the carbazole ring, which can affect its electronic properties and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C13H13NO2
InChI:InChI=1S/C13H13NO2/c15-13(16)9-5-3-7-11-12(9)8-4-1-2-6-10(8)14-11/h3,5,7,14H,1-2,4,6H2,(H,15,16)
InChI key:InChIKey=JATFYKRYLHPWLZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C3=C(NC2=CC=C1)CCCC3
Synonyms:- 2,3,4,9-Tetrahydro-1H-carbazole-5-carboxylic acid
- 1H-Carbazole-5-carboxylic acid, 2,3,4,9-tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.