CAS 78416-43-0
:methyl 5-amino-1H-indazole-4-carboxylate
Description:
Methyl 5-amino-1H-indazole-4-carboxylate, with the CAS number 78416-43-0, is a chemical compound that belongs to the indazole class of compounds, characterized by a five-membered aromatic ring structure containing nitrogen. This compound features an amino group (-NH2) and a carboxylate group (-COO-) attached to the indazole ring, which contributes to its potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of functional groups. The compound is of interest in medicinal chemistry and drug development, particularly for its potential applications in treating various diseases. Its structure allows for various chemical modifications, which can enhance its pharmacological properties. As with many organic compounds, it is important to handle methyl 5-amino-1H-indazole-4-carboxylate with care, following appropriate safety protocols, as it may have specific toxicity or reactivity profiles.
Formula:C9H9N3O2
InChI:InChI=1/C9H9N3O2/c1-14-9(13)8-5-4-11-12-7(5)3-2-6(8)10/h2-4H,10H2,1H3,(H,11,12)
SMILES:COC(=O)c1c2c[nH]nc2ccc1N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
