CymitQuimica logo

CAS 784161-48-4

:

1-Boc-2-indolyldimethylsilanol

Description:
1-Boc-2-indolyldimethylsilanol is a chemical compound characterized by the presence of a silanol functional group, which is a silicon atom bonded to a hydroxyl group. The "Boc" (tert-butyloxycarbonyl) group serves as a protective group for amines, enhancing the compound's stability and reactivity in synthetic applications. The indole moiety contributes to the compound's aromatic properties and potential biological activity, making it of interest in medicinal chemistry. The dimethylsilanol aspect indicates that the silicon atom is bonded to two methyl groups, which can influence the compound's solubility and reactivity. This compound is typically utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its unique structure allows for versatility in functionalization, making it a valuable intermediate in the synthesis of more complex molecules. As with many silanol compounds, it may exhibit properties such as hydrogen bonding and varying degrees of polarity, affecting its interactions in different chemical environments.
Formula:C15H21NO3Si
InChI:InChI=1/C15H21NO3Si/c1-15(2,3)19-14(17)16-12-9-7-6-8-11(12)10-13(16)20(4,5)18/h6-10,18H,1-5H3
SMILES:CC(C)(C)OC(=O)n1c2ccccc2cc1[Si](C)(C)O
Synonyms:
  • Tert-Butyl 2-(Hydroxy-Dimethyl-Silyl)Indole-1-Carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.