CAS 78417-90-0
:2-hydroxy-5-octanoyl-N-[3-(trifluoromethyl)phenyl]benzamide
Description:
2-Hydroxy-5-octanoyl-N-[3-(trifluoromethyl)phenyl]benzamide, with the CAS number 78417-90-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a hydroxyl group, an octanoyl chain, and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with both hydrophilicity due to the hydroxyl group and lipophilicity from the octanoyl chain, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The presence of the trifluoromethyl group can enhance the compound's biological activity and stability, as fluorinated compounds often exhibit unique interactions in biological systems. Additionally, the compound may display specific melting and boiling points, solubility characteristics, and reactivity patterns that are influenced by its functional groups. Its synthesis and handling require careful consideration of safety protocols due to the presence of fluorinated components, which can pose environmental and health risks. Overall, this compound represents a class of molecules with diverse applications in medicinal chemistry and materials science.
Formula:C22H24F3NO3
InChI:InChI=1/C22H24F3NO3/c1-2-3-4-5-6-10-19(27)15-11-12-20(28)18(13-15)21(29)26-17-9-7-8-16(14-17)22(23,24)25/h7-9,11-14,28H,2-6,10H2,1H3,(H,26,29)
SMILES:CCCCCCCC(=O)c1ccc(c(c1)C(=Nc1cccc(c1)C(F)(F)F)O)O
Synonyms:- benzamide, 2-hydroxy-5-(1-oxooctyl)-N-[3-(trifluoromethyl)phenyl]-
- salifluor
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Salifluor
CAS:<p>Salifluor is a broad spectrum antimicrobial agent that has been investigated for its abilities to inhibit dental plaque formation.</p>Formula:C22H24F3NO3Color and Shape:SolidMolecular weight:407.43
