CAS 784172-04-9

5-[[(2-Methoxyethyl)amino]sulfonyl]-2-methylbenzoic acid

Description:

5-[[(2-Methoxyethyl)amino]sulfonyl]-2-methylbenzoic acid, with the CAS number 784172-04-9, is a chemical compound characterized by its unique functional groups and structural features. It contains a benzoic acid moiety, which contributes to its acidity and potential for forming salts or esters. The presence of a sulfonamide group enhances its solubility in polar solvents and may influence its biological activity. The methoxyethyl substituent suggests that the compound may exhibit moderate lipophilicity, allowing it to interact with biological membranes. This compound is likely to be of interest in medicinal chemistry, potentially serving as a lead compound for drug development due to its structural complexity and the presence of multiple functional groups that can participate in various chemical reactions. Its specific properties, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior.

Formula: C₁₁H₁₅NO₅S

InChI: InChI=1S/C11H15NO5S/c1-8-3-4-9(7-10(8)11(13)14)18(15,16)12-5-6-17-2/h3-4,7,12H,5-6H2,1-2H3,(H,13,14)

InChI key: InChIKey=UYUYYHVCJNFKSN-UHFFFAOYSA-N

SMILES: S(NCCOC)(=O)(=O)C1=CC(C(O)=O)=C(C)C=C1

Synonyms:

• Benzoic acid, 5-[[(2-methoxyethyl)amino]sulfonyl]-2-methyl-
• 5-[[(2-Methoxyethyl)amino]sulfonyl]-2-methylbenzoic acid

5-[(2-Methoxyethyl)sulfamoyl]-2-methylbenzoic acid

CAS: 784172-04-9

5-[(2-Methoxyethyl)sulfamoyl]-2-methylbenzoic acid is a Carbohydrate, Modification, saccharide, Oligosaccharide. CAS No. 784172-04-9. It is a sugar that has been Fluorinated and complexed with other sugars to form an oligosaccharide, which can be synthesized using Custom synthesis methods. The purity of 5-[(2-Methoxyethyl)sulfamoyl]-2-methylbenzoic acid is High and it is synthesized with Methylation or Glycosylation methods. This compound has Click modification available as an option.

Formula: C₁₁H₁₅NO₅S

Purity: Min. 95%

Molecular weight: 273.31 g/mol

Ref: 3D-JGB17204