CAS 784181-89-1
:1-[(3-Fluorophenyl)methyl]pyrrolidine
Description:
1-[(3-Fluorophenyl)methyl]pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a 3-fluorobenzyl group. The presence of the fluorine atom on the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its interaction with biological targets. This compound is typically classified as an organic amine due to the nitrogen atom in the pyrrolidine ring. It may exhibit various pharmacological activities, making it of interest in medicinal chemistry. The molecular structure allows for potential interactions with neurotransmitter systems, which could be relevant in the development of therapeutic agents. Additionally, the compound's solubility and stability can be influenced by the substituents on the aromatic ring and the cyclic amine structure. As with many organic compounds, safety and handling precautions are essential, particularly in laboratory settings, due to potential toxicity or reactivity. Overall, 1-[(3-Fluorophenyl)methyl]pyrrolidine represents a versatile scaffold for further chemical exploration and application in drug discovery.
Formula:C11H14FN
InChI:InChI=1S/C11H14FN/c12-11-5-3-4-10(8-11)9-13-6-1-2-7-13/h3-5,8H,1-2,6-7,9H2
InChI key:InChIKey=PRKCBGIXZFUCEF-UHFFFAOYSA-N
SMILES:C(C1=CC(F)=CC=C1)N2CCCC2
Synonyms:- 1-[(3-Fluorophenyl)methyl]pyrrolidine
- 1-(3-Fluorobenzyl)pyrrolidine
- Pyrrolidine, 1-[(3-fluorophenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.