CAS 78425-12-4

3-(1H-Pyrazol-1-ylmethyl)benzenemethanol

Description:

3-(1H-Pyrazol-1-ylmethyl)benzenemethanol, with the CAS number 78425-12-4, is an organic compound characterized by its unique structure that includes a pyrazole ring and a benzyl alcohol moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as moderate solubility in polar solvents due to the presence of the hydroxyl (-OH) group. The pyrazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may display various functional properties, including the ability to participate in hydrogen bonding due to the hydroxyl group, which can influence its reactivity and interactions with other molecules. Additionally, the presence of both the pyrazole and benzene structures may impart specific electronic characteristics, affecting its stability and reactivity in chemical reactions. Overall, 3-(1H-Pyrazol-1-ylmethyl)benzenemethanol is a compound of interest for further research, particularly in the fields of pharmaceuticals and organic synthesis.

Formula: C₁₁H₁₂N₂O

InChI: InChI=1S/C11H12N2O/c14-9-11-4-1-3-10(7-11)8-13-6-2-5-12-13/h1-7,14H,8-9H2

InChI key: InChIKey=MKWUOFLESOBOSK-UHFFFAOYSA-N

SMILES: C(C1=CC(CO)=CC=C1)N2C=CC=N2

Synonyms:

• [3-(1H-Pyrazol-1-ylmethyl)phenyl]methanol
• Benzenemethanol, 3-(1H-pyrazol-1-ylmethyl)-
• 3-(1H-Pyrazol-1-ylmethyl)benzenemethanol
• [3-[(1H-Pyrazol-1-yl)methyl]phenyl]methanol
• [3-(Pyrazol-1-ylmethyl)phenyl]methanol

[3-(1H-Pyrazol-1-ylmethyl)phenyl]methanol

CAS: 78425-12-4

[3-(1H-Pyrazol-1-ylmethyl)phenyl]methanol

Purity: ≥95%

Molecular weight: 188.23g/mol

Ref: 54-OR110015