
CAS 78441-63-1
:2-Thiazolemethanamine, 4-[[(2-aminoethyl)thio]methyl]-N,N-dimethyl-, ethanedioate (1:2)
Description:
2-Thiazolemethanamine, 4-[[(2-aminoethyl)thio]methyl]-N,N-dimethyl-, ethanedioate (1:2), with CAS number 78441-63-1, is a chemical compound characterized by its thiazole ring structure, which contributes to its biological activity and potential applications in pharmaceuticals. This compound features a thiazole moiety linked to a dimethylamino group and an aminoethylthio side chain, indicating its potential as a bioactive molecule. The ethanedioate (oxalate) component suggests that it may form salts or complexes, enhancing its solubility and stability in various environments. The presence of both amino and thio groups indicates potential reactivity and interaction with biological systems, making it of interest in medicinal chemistry. Its unique structure may confer specific properties such as antimicrobial or antifungal activity, although detailed studies would be necessary to elucidate its full biological profile. Overall, this compound exemplifies the complexity and diversity of thiazole derivatives in chemical research and development.
Formula:C9H17N3S2.2C2H2O4
InChI:InChI=1S/C9H17N3S2.C2H2O4/c1-12(2)5-9-11-8(7-14-9)6-13-4-3-10;3-1(4)2(5)6/h7H,3-6,10H2,1-2H3;(H,3,4)(H,5,6)
InChI key:InChIKey=SCXGEATYEJWAHE-UHFFFAOYSA-N
SMILES:C(C(O)=O)(O)=O.C(N(C)C)C1=NC(CSCCN)=CS1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-[[[2-[(Dimethylamino)methyl]thiazol-4-yl]methyl]sulphanyl]ethanamine Dioxalate
CAS:Controlled ProductFormula:C9H17N3S2C2H2O4Color and Shape:NeatMolecular weight:411.45
