CAS 78441-82-4
:4-hydroxybenzo[de]naphtho[1,8-gh]cinnolin-3(2H)-one
Description:
4-Hydroxybenzo[de]naphtho[1,8-gh]cinnolin-3(2H)-one, with the CAS number 78441-82-4, is a chemical compound that belongs to the class of naphthoquinones and is characterized by its complex polycyclic structure. This compound features a hydroxyl group (-OH) and a cinnolinone moiety, which contributes to its potential biological activity. It is typically a solid at room temperature and may exhibit various colors depending on its purity and form. The presence of the hydroxyl group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, compounds of this type are often studied for their potential applications in pharmaceuticals, particularly due to their ability to interact with biological systems. The specific properties, such as melting point, solubility, and spectral characteristics, can vary based on the compound's purity and the conditions under which it is studied. Overall, this compound represents a fascinating area of research in organic and medicinal chemistry.
Formula:C18H10N2O2
InChI:InChI=1/C18H10N2O2/c21-13-8-7-11-10-5-1-3-9-4-2-6-12(14(9)10)17-15(11)16(13)18(22)20-19-17/h1-8,21H,(H,20,22)
SMILES:c1cc2cccc3c2c(c1)c1ccc(c2c1c3nnc2O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-[2-[[5-[(Dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylimino]-1-oxido-1,2,5-thiadiazol-1-ium-3-amine
CAS:4-[2-[[5-[(Dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethylimino]-1-oxido-1,2,5-thiadiazol-1-ium-3-amine (PD 03055) is an inhibitor of the a7 subunit of the nicotinic acetylcholine receptor. PD 03055 has been shown to inhibit the binding of acetylcholine and nicotine to nicotinic acetylcholine receptors in rat brain tissue, as well as to inhibit the binding of [3H]epibatidine to these receptors in rat cerebral cortex tissue. This peptide is being developed as a research tool for studies on ion channels and protein interactions.Formula:C12H19N5O2S2Purity:Min. 95%Molecular weight:329.4 g/molBMY-25271
CAS:BMY-25271 is an antagonist of histamine H2 receptor.Formula:C12H19N5O2S2Purity:98%Color and Shape:SolidMolecular weight:329.44

