CAS 78443-72-8
:2,4-Dichloro-6-hydroxybenzaldehyde
Description:
2,4-Dichloro-6-hydroxybenzaldehyde is an organic compound characterized by its aromatic structure, featuring a benzaldehyde functional group along with two chlorine substituents and a hydroxyl group. The presence of the aldehyde group (-CHO) indicates that it can participate in various chemical reactions, such as oxidation and condensation. The two chlorine atoms, located at the 2 and 4 positions on the benzene ring, contribute to the compound's reactivity and influence its physical properties, such as solubility and boiling point. The hydroxyl group at the 6 position enhances the compound's polarity, making it more soluble in polar solvents. This compound may exhibit biological activity, making it of interest in fields such as medicinal chemistry and agrochemicals. Its synthesis typically involves chlorination and hydroxylation of a suitable precursor, and it can be analyzed using techniques like NMR and mass spectrometry to confirm its structure. Overall, 2,4-Dichloro-6-hydroxybenzaldehyde is a versatile compound with potential applications in various chemical and pharmaceutical industries.
Formula:C7H4Cl2O2
InChI:InChI=1/C7H4Cl2O2/c8-4-1-6(9)5(3-10)7(11)2-4/h1-3,11H
SMILES:c1c(cc(c(C=O)c1Cl)O)Cl
Synonyms:- 4,6-Dichlorosalicylaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,4-Dichloro-6-hydroxybenzaldehyde
CAS:Formula:C7H4Cl2O2Purity:98%Color and Shape:SolidMolecular weight:191.01154,6-Dichlorosalicylaldehyde
CAS:4,6-DichlorosalicylaldehydeFormula:C7H4Cl2O2Purity:98%Color and Shape: yellow solidMolecular weight:191.01g/mol2,4-Dichloro-6-hydroxybenzaldehyde
CAS:2,4-Dichloro-6-hydroxybenzaldehyde is a potential antineoplastic agent that inhibits mitochondrial function and induces apoptosis. This drug blocks the mitochondrial membrane potential and inhibits ATP production by blocking the mitochondrial respiratory chain complexes I and III. 2,4-Dichloro-6-hydroxybenzaldehyde has been shown to inhibit tumor cell growth in culture and in animal models of cancer. It also selectively kills tumor cells with low levels of cisplatin resistance through concurrent inhibition of mitochondria and caspase activation. 2,4-Dichloro-6-hydroxybenzaldehyde binds to both the inner membrane of mitochondria and to the plasma membrane of cancer cells, thereby inhibiting their function.Formula:C7H4Cl2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:191.01 g/mol2,4-Dichloro-6-hydroxybenzaldehyde
CAS:Formula:C7H4Cl2O2Purity:95%Color and Shape:SolidMolecular weight:191.01



