CymitQuimica logo

CAS 78449-68-0

:

1H-Imidazole-5-carboxylic acid, 1-ethyl-4-methyl-

Description:
1H-Imidazole-5-carboxylic acid, 1-ethyl-4-methyl- is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxylic acid functional group, contributing to its acidic properties, and an ethyl and a methyl substituent that influence its solubility and reactivity. The presence of the imidazole moiety suggests potential biological activity, as imidazole derivatives are often found in various pharmaceuticals and biochemical applications. The compound is likely to be soluble in polar solvents due to the carboxylic acid group, while the alkyl substituents may enhance its lipophilicity. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit properties such as buffering capacity and chelation, which are common in imidazole derivatives. Overall, 1H-Imidazole-5-carboxylic acid, 1-ethyl-4-methyl- is a versatile compound with potential applications in various fields, including pharmaceuticals and biochemistry.
Formula:C7H10N2O2
InChI:InChI=1S/C7H10N2O2/c1-3-9-4-8-5(2)6(9)7(10)11/h4H,3H2,1-2H3,(H,10,11)
InChI key:InChIKey=IVRLKXWMRLCMPV-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N(CC)C=NC1C
Synonyms:
  • 1H-Imidazole-5-carboxylic acid, 1-ethyl-4-methyl-
  • 1-Ethyl-4-methyl-1H-imidazole-5-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.