CymitQuimica logo

CAS 78456-98-1

:

2,7-dihydroxy-1,3,2-benzodioxaborole-5-carboxylic acid

Description:
2,7-Dihydroxy-1,3,2-benzodioxaborole-5-carboxylic acid is a boron-containing organic compound characterized by its unique bicyclic structure, which includes a dioxaborole ring. This compound features two hydroxyl groups and a carboxylic acid functional group, contributing to its potential reactivity and solubility in polar solvents. The presence of boron in its structure often imparts interesting properties, such as the ability to form complexes with various substrates, making it useful in organic synthesis and materials science. The hydroxyl groups can participate in hydrogen bonding, enhancing its solubility in aqueous environments and potentially influencing its biological activity. Additionally, the carboxylic acid group can undergo typical acid-base reactions, further expanding its utility in chemical reactions. Overall, 2,7-dihydroxy-1,3,2-benzodioxaborole-5-carboxylic acid is notable for its structural complexity and functional versatility, making it a compound of interest in various fields, including medicinal chemistry and polymer science.
Formula:C7H5BO6
InChI:InChI=1/C7H5BO6/c9-4-1-3(7(10)11)2-5-6(4)14-8(12)13-5/h1-2,9,12H,(H,10,11)
Synonyms:
  • 1,3,2-Benzodioxaborole-5-carboxylic acid, 2,7-dihydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.