CAS 78466-98-5

6,8-Dihydro-3,8-dimethyl-4-phenylpyrazolo[3,4-b][1,4]diazepine-5,7(1H,4H)-dione

Description:

6,8-Dihydro-3,8-dimethyl-4-phenylpyrazolo[3,4-b][1,4]diazepine-5,7(1H,4H)-dione, with the CAS number 78466-98-5, is a complex organic compound characterized by its unique bicyclic structure that incorporates both pyrazole and diazepine moieties. This compound features a phenyl group and two methyl groups, contributing to its diverse chemical properties and potential biological activities. It is typically classified as a heterocyclic compound due to the presence of nitrogen atoms in its ring structure. The presence of carbonyl groups (diones) suggests potential reactivity in various chemical reactions, including nucleophilic attacks. The compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of new therapeutic agents. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. Overall, 6,8-Dihydro-3,8-dimethyl-4-phenylpyrazolo[3,4-b][1,4]diazepine-5,7(1H,4H)-dione represents a significant structure for further research in both synthetic and medicinal chemistry.

Formula: C₁₄H₁₄N₄O₂

InChI: InChI=1S/C14H14N4O2/c1-9-13-14(16-15-9)17(2)11(19)8-12(20)18(13)10-6-4-3-5-7-10/h3-7H,8H2,1-2H3,(H,15,16)

InChI key: InChIKey=RHZDHINXKVZTEF-UHFFFAOYSA-N

SMILES: CC=1C=2N(C(=O)CC(=O)N(C)C2NN1)C3=CC=CC=C3

Synonyms:

• Pyrazolo[3,4-b][1,4]diazepine-5,7(1H,4H)-dione, 6,8-dihydro-3,8-dimethyl-4-phenyl-
• 6,8-Dihydro-3,8-dimethyl-4-phenylpyrazolo[3,4-b][1,4]diazepine-5,7(1H,4H)-dione
• Pyrazolo[3,4-b][1,4]diazepine-5,7(1H,6H)-dione, 4,8-dihydro-3,8-dimethyl-4-phenyl-
• Razobazam
• HOE 175

Razobazam

CAS: 78466-98-5

Razobazam is a benzodiazepine derivative agent. It produces nootropic (improves cognitive function) effects in animal studies.

Formula: C₁₄H₁₄N₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 270.29

Ref: TM-T26045