CAS 78469-11-1

α,α,2,4-Tetramethylbenzenemethanamine

Description:

α,α,2,4-Tetramethylbenzenemethanamine, also known by its CAS number 78469-11-1, is an organic compound characterized by a complex structure featuring a benzene ring with multiple methyl substituents and an amine functional group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of four methyl groups on the benzene ring contributes to its steric hindrance, potentially affecting its reactivity and interactions with other molecules. Additionally, the compound may display hydrophobic characteristics due to the bulky alkyl groups, which can impact its behavior in biological systems and industrial applications. Its specific applications may vary, but compounds of this nature are often explored in fields such as pharmaceuticals, agrochemicals, and materials science. Safety data should be consulted for handling and usage, as amines can be hazardous in certain contexts.

Formula: C₁₁H₁₇N

InChI: InChI=1S/C11H17N/c1-8-5-6-10(9(2)7-8)11(3,4)12/h5-7H,12H2,1-4H3

InChI key: InChIKey=FEOAGOLKFMQCCI-UHFFFAOYSA-N

SMILES: C(C)(C)(N)C1=C(C)C=C(C)C=C1

Synonyms:

• Benzenemethanamine, α,α,2,4-tetramethyl-
• α,α,2,4-Tetramethylbenzenemethanamine
• 2-(2,4-Dimethylphenyl)propan-2-amine