CAS 78471-44-0

1-(4-chlorobenzyl)piperidin-4-amine

Description:

1-(4-chlorobenzyl)piperidin-4-amine, identified by its CAS number 78471-44-0, is a chemical compound characterized by its piperidine structure, which includes a piperidine ring substituted with a 4-chlorobenzyl group and an amino group at the 4-position. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the chlorobenzyl group may impart specific electronic and steric effects, potentially affecting its biological activity and interactions with other molecules. It is often studied in the context of medicinal chemistry due to its potential pharmacological applications. The compound's stability, reactivity, and interactions can vary based on environmental conditions such as pH and temperature. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₂H₁₇ClN₂

InChI: InChI=1/C12H17ClN2/c13-11-3-1-10(2-4-11)9-15-7-5-12(14)6-8-15/h1-4,12H,5-9,14H2

SMILES: c1cc(ccc1CN1CCC(CC1)N)Cl

1-[(4-Chlorophenyl)methyl]piperidin-4-amine

CAS: 78471-44-0

Please enquire for more information about 1-[(4-Chlorophenyl)methyl]piperidin-4-amine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Purity: Min. 95%

Molecular weight: 224.7 g/mol

Ref: 3D-DDA47144