CAS 78478-28-1
:(9S,10S)-8,8-dimethyl-10-[(3-methylbutanoyl)oxy]-2-oxo-9,10-dihydro-2H,8H-pyrano[2,3-f]chromen-9-yl (2Z)-2-methylbut-2-enoate
Description:
The chemical substance with the name "(9S,10S)-8,8-dimethyl-10-[(3-methylbutanoyl)oxy]-2-oxo-9,10-dihydro-2H,8H-pyrano[2,3-f]chromen-9-yl (2Z)-2-methylbut-2-enoate" and CAS number "78478-28-1" is a complex organic compound characterized by its unique structural features, including multiple chiral centers and functional groups. It belongs to the class of pyranochromenes, which are known for their diverse biological activities and potential applications in pharmaceuticals. The presence of a pyran ring fused to a chromene structure contributes to its stability and reactivity. The compound features a dimethyl substitution and an ester functional group, which may influence its solubility and interaction with biological systems. Additionally, the specific stereochemistry indicated by the (9S,10S) configuration suggests that it may exhibit specific optical activity, which can be crucial for its biological efficacy. Overall, this compound's intricate structure and functional groups make it a subject of interest for further research in medicinal chemistry and natural product synthesis.
Formula:C24H28O7
InChI:InChI=1/C24H28O7/c1-7-14(4)23(27)30-22-21(29-18(26)12-13(2)3)19-16(31-24(22,5)6)10-8-15-9-11-17(25)28-20(15)19/h7-11,13,21-22H,12H2,1-6H3/b14-7-/t21-,22-/m0/s1
SMILES:C/C=C(/C)\C(=O)O[C@H]1[C@H](c2c(ccc3ccc(=O)oc23)OC1(C)C)OC(=O)CC(C)C
Synonyms:- 2-butenoic acid, 2-methyl-, (9S,10S)-9,10-dihydro-8,8-dimethyl-10-(3-methyl-1-oxobutoxy)-2-oxo-2H,8H-benzo[1,2-b:3,4-b']dipyran-9-yl ester, (2Z)-
- Praeruptorin E
- (+)-praeruptorin B
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Praeruptorin E
CAS:<p>Praeruptorin C/E relaxes arteries, reduces heart contractility, acting like calcium blockers. D/E protect mice from acid lung injury by halting PMNs and IL-6.</p>Formula:C24H28O7Purity:98.04% - 99.95%Color and Shape:SolidMolecular weight:428.47Praeruptorin e
CAS:LactoneFormula:C24H28O7Purity:≥ 98.0 % (HPLC)Color and Shape:CrystalsMolecular weight:428.47Praeruptorin E
CAS:<p>Praeruptorin E is a natural furanocoumarin, which is derived from the roots of Peucedanum praeruptorum, a plant commonly used in traditional Chinese medicine. As a bioactive compound, Praeruptorin E exhibits significant pharmacological activities, particularly in cardiovascular, anti-inflammatory, and cytoprotective domains.</p>Purity:Min. 95%2-Butenoic acid, 2-methyl-,(9S,10S)-9,10-dihydro-8,8-dimethyl-10-(3-methyl-1-oxobutoxy)-2-oxo-2H,8H-benzo[1,2-b:3,4-b']dipyran-9-yl ester, (2Z)-
CAS:Formula:C24H28O7Purity:98%Molecular weight:428.4749







