
CAS 784984-08-3
:5-(4-Methylphenyl)proline
Description:
5-(4-Methylphenyl)proline, with the CAS number 784984-08-3, is an organic compound that belongs to the class of proline derivatives. It features a proline backbone, which is an amino acid known for its cyclic structure, and is substituted with a 4-methylphenyl group at the 5-position. This substitution contributes to its unique chemical properties, including its potential for forming hydrogen bonds and participating in various chemical reactions. The presence of the aromatic methyl group enhances its lipophilicity, which may influence its solubility in organic solvents. Additionally, this compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its structural characteristics suggest potential applications in the synthesis of pharmaceuticals or as a building block in organic synthesis. As with many proline derivatives, it may also play a role in influencing the conformation of peptides and proteins due to its ability to introduce rigidity into molecular structures.
Formula:C12H15NO2
InChI:InChI=1S/C12H15NO2/c1-8-2-4-9(5-3-8)10-6-7-11(13-10)12(14)15/h2-5,10-11,13H,6-7H2,1H3,(H,14,15)
InChI key:InChIKey=SKQLXMFYXIIUIN-UHFFFAOYSA-N
SMILES:C(O)(=O)C1NC(CC1)C2=CC=C(C)C=C2
Synonyms:- 5-(4-Methylphenyl)proline
- Proline, 5-(4-methylphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.