CAS 785-81-9
:4-nitro-N-[(E)-phenylmethylidene]aniline
Description:
4-Nitro-N-[(E)-phenylmethylidene]aniline, with the CAS number 785-81-9, is an organic compound characterized by its aromatic structure and functional groups. It features a nitro group (-NO2) attached to an aniline moiety, which is an amine derivative of benzene. The compound also contains a phenylmethylidene group, indicating the presence of a double bond between the phenyl ring and the imine carbon. This configuration contributes to its potential reactivity and stability. The presence of the nitro group typically enhances the compound's electron-withdrawing properties, influencing its chemical behavior and interactions. 4-Nitro-N-[(E)-phenylmethylidene]aniline may exhibit properties such as solubility in organic solvents, and it can participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic addition. Its applications may extend to fields such as organic synthesis, dye production, and as an intermediate in the manufacture of pharmaceuticals. Safety precautions should be taken when handling this compound due to the potential toxicity associated with nitroaromatic compounds.
Formula:C13H10N2O2
InChI:InChI=1/C13H10N2O2/c16-15(17)13-8-6-12(7-9-13)14-10-11-4-2-1-3-5-11/h1-10H/b14-10+
Synonyms:- 4-nitro-N-[(1E)-phenylmethylene]aniline
- 4-Nitro-N-[(E)-phenylmethylene]aniline
- Benzenamine, 4-nitro-N-(phenylmethylene)-
- benzenamine, 4-nitro-N-[(1E)-phenylmethylene]-
- Benzylidene-(4-nitrophenyl)-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.