CAS 785038-49-5
:(R)-3-Amino-4-(3-chlorophenyl)butyric acid
Description:
(R)-3-Amino-4-(3-chlorophenyl)butyric acid, identified by its CAS number 785038-49-5, is an amino acid derivative characterized by its chiral center, which imparts specific stereochemical properties. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH), typical of amino acids, allowing it to participate in various biochemical reactions. The presence of the 3-chlorophenyl group contributes to its hydrophobic characteristics, influencing its solubility and interaction with biological membranes. This compound is often studied for its potential pharmacological applications, particularly in the context of neurological disorders, due to its structural similarity to neurotransmitters. Its chirality is significant in determining its biological activity, as different enantiomers can exhibit distinct effects in biological systems. Additionally, the compound's stability, reactivity, and interaction with other molecules can be influenced by environmental factors such as pH and temperature. Overall, (R)-3-Amino-4-(3-chlorophenyl)butyric acid represents a valuable compound in medicinal chemistry and pharmacology.
Formula:C10H12ClNO2
InChI:InChI=1/C10H12ClNO2/c11-8-3-1-2-7(4-8)5-9(12)6-10(13)14/h1-4,9H,5-6,12H2,(H,13,14)/t9-/m1/s1
SMILES:c1cc(cc(c1)Cl)C[C@H](CC(=O)O)N
Synonyms:- (3R)-3-Amino-4-(3-chlorophenyl)butanoic acid
- benzenebutanoic acid, beta-amino-3-chloro-, (betaR)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
