CAS 78508-46-0

1-(4-bromo-3-methylphenyl)urea

Description:

1-(4-bromo-3-methylphenyl)urea, with the CAS number 78508-46-0, is an organic compound that features a urea functional group attached to a substituted phenyl ring. The presence of a bromine atom and a methyl group on the aromatic ring contributes to its unique chemical properties. This compound typically appears as a solid at room temperature and is characterized by its moderate solubility in organic solvents, while being less soluble in water. The bromine substituent can enhance the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the methyl group can influence the electronic properties of the molecule, potentially affecting its biological activity. 1-(4-bromo-3-methylphenyl)urea may be of interest in pharmaceutical research and development due to its potential applications in medicinal chemistry. As with many organic compounds, proper handling and safety precautions should be observed, as it may pose health risks if ingested or inhaled.

Formula: C₈H₉BrN₂O

InChI: InChI=1/C8H9BrN2O/c1-5-4-6(11-8(10)12)2-3-7(5)9/h2-4H,1H3,(H3,10,11,12)

SMILES: Cc1cc(ccc1Br)NC(=N)O

Synonyms:

• (4-Bromo-3-Methylphenyl)Urea

(4-Bromo-3-methylphenyl)urea

CAS: 78508-46-0

Versatile small molecule scaffold

Formula: C₈H₉BrN₂O

Purity: Min. 95%

Molecular weight: 229.07 g/mol

Ref: 3D-DDA50846