CAS 78510-05-1
:(2R)-2-hydroxy-N-methyl-3-(2-prop-2-en-1-ylphenoxy)propan-1-aminium
Description:
(2R)-2-hydroxy-N-methyl-3-(2-prop-2-en-1-ylphenoxy)propan-1-aminium, with the CAS number 78510-05-1, is a quaternary ammonium compound characterized by its complex structure that includes a hydroxyl group, a methyl group, and a phenoxy moiety. This compound typically exhibits properties associated with quaternary ammonium compounds, such as being a cationic surfactant, which can enhance its solubility in water and its ability to interact with various biological membranes. The presence of the alkenyl group (prop-2-en-1-yl) suggests potential reactivity, making it useful in various chemical reactions, including polymerization processes. Additionally, the hydroxyl group contributes to its potential as a hydrogen bond donor, influencing its interactions in biological systems. Its unique structure may also impart specific biological activities, making it of interest in pharmaceutical and agrochemical applications. Overall, this compound's characteristics make it a versatile candidate for further research and application in various fields.
Formula:C13H20NO2
InChI:InChI=1/C13H19NO2/c1-3-6-11-7-4-5-8-13(11)16-10-12(15)9-14-2/h3-5,7-8,12,14-15H,1,6,9-10H2,2H3/p+1/t12-/m0/s1
Synonyms:- (2S)-2-hydroxy-N-methyl-3-(2-prop-2-en-1-ylphenoxy)propan-1-aminium
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
