CAS 78524-73-9
:4,6-diamino-2-{[3-O-(2-amino-2-deoxyhexopyranosyl)pentofuranosyl]oxy}-3-hydroxycyclohexyl 2,6-diamino-2,6-dideoxyhexopyranoside
Description:
4,6-Diamino-2-{[3-O-(2-amino-2-deoxyhexopyranosyl)pentofuranosyl]oxy}-3-hydroxycyclohexyl 2,6-diamino-2,6-dideoxyhexopyranoside is a complex organic compound characterized by its multiple amino and hydroxyl functional groups, which contribute to its solubility and reactivity. The presence of amino groups suggests potential for hydrogen bonding and interaction with biological systems, making it of interest in medicinal chemistry. The structure includes a cyclohexyl moiety, which may influence its conformational flexibility and steric properties. Additionally, the glycosidic linkages involving deoxyhexopyranosyl units indicate that this compound may exhibit properties similar to carbohydrates, potentially affecting its biological activity and interactions with enzymes or receptors. Its CAS number, 78524-73-9, allows for precise identification in chemical databases. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of glycosylated drugs or as a scaffold for further chemical modifications.
Formula:C23H45N5O14
InChI:InChI=1/C23H45N5O14/c24-2-7-13(32)15(34)10(27)21(37-7)40-18-6(26)1-5(25)12(31)20(18)42-23-17(36)19(9(4-30)39-23)41-22-11(28)16(35)14(33)8(3-29)38-22/h5-23,29-36H,1-4,24-28H2
Synonyms:- 6-Deamino-6-hydroxyneomycin
- 6'''-Deamino-6'''-hydroxyneomycin B dihydrate
- 6'''-deamino-6'''-hydroxyneomycin B
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
6"'-Deamino-6"'-hydroxyneomycin B
CAS:6"'-Deamino-6"'-hydroxyneomycin B is an aminoglycoside antibiotic produced by [Streptomyces fradiaeUC 75]. It is effective against both Gram-positive and Gram-negative bacteria and serves as an intermediate in the biosynthesis of neomycin.Formula:C23H45N5O14Color and Shape:SolidMolecular weight:615.628

