CAS 78531-30-3

1,3-Dimethoxy-N-methyl-2-propanamine

Description:

1,3-Dimethoxy-N-methyl-2-propanamine, with the CAS number 78531-30-3, is an organic compound characterized by its amine functional group and methoxy substituents. This substance features a propanamine backbone, where the nitrogen atom is bonded to a methyl group and two methoxy groups at the 1 and 3 positions of the carbon chain. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Typically, compounds of this nature can exhibit properties such as moderate volatility and potential basicity due to the amine group. The molecular structure suggests that it may participate in hydrogen bonding, which can affect its physical properties, such as boiling point and melting point. Additionally, the compound may have applications in pharmaceuticals or as a chemical intermediate, although specific uses would depend on further research and regulatory assessments. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.

Formula: C₆H₁₅NO₂

InChI: InChI=1S/C6H15NO2/c1-7-6(4-8-2)5-9-3/h6-7H,4-5H2,1-3H3

InChI key: InChIKey=VWTRQZQYASNOGM-UHFFFAOYSA-N

SMILES: C(COC)(COC)NC

Synonyms:

• (1,3-Dimethoxypropan-2-yl)(methyl)amine
• 2-Propanamine, 1,3-dimethoxy-N-methyl-
• 1,3-Dimethoxy-N-methyl-2-propanamine