CAS 78540-03-1

1-phenyl-1H-pyrrole-2-carboxylic acid

Description:

1-Phenyl-1H-pyrrole-2-carboxylic acid is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a phenyl group attached to the nitrogen of the pyrrole and a carboxylic acid functional group at the 2-position of the pyrrole ring. It typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of the carboxylic acid group. The compound may participate in various chemical reactions, including acid-base reactions due to the carboxylic acid functionality, and can serve as a building block in organic synthesis. Its unique structure allows for potential applications in pharmaceuticals, agrochemicals, or as a ligand in coordination chemistry. Additionally, the presence of both aromatic and heterocyclic components may contribute to interesting electronic properties, making it a subject of interest in materials science and medicinal chemistry.

Formula: C₁₁H₉NO₂

InChI: InChI=1/C11H9NO2/c13-11(14)10-7-4-8-12(10)9-5-2-1-3-6-9/h1-8H,(H,13,14)

SMILES: c1ccc(cc1)n1cccc1C(=O)O

Synonyms:

• 1H-pyrrole-2-carboxylic acid, 1-phenyl-

1-Phenyl-1H-pyrrole-2-carboxylic acid

CAS: 78540-03-1

Formula: C₁₁H₉NO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 187.1947

Ref: IN-DA005L9U

1-Phenylpyrrole-2-carboxylic acid

CAS: 78540-03-1

1-Phenylpyrrole-2-carboxylic acid

Formula: C₁₁H₉NO₂

Purity: 97%

Color and Shape: brown powder

Molecular weight: 187.19g/mol

Ref: 54-OR902874

1-Phenyl-1H-pyrrole-2-carboxylic acid

CAS: 78540-03-1

1-Phenyl-1H-pyrrole-2-carboxylic acid is a heterocyclic compound with a carbonyl group. It is the simplest furan derivative. 1PPC has been shown to react with phosphite and trimethyl phosphite to form an intramolecular cycloaddition product, which is a biomolecular reaction. 1PPC competes with furan for the formation of pyrroles. This study also showed that pyrrole rings can be opened by 1PPC and other carbonyl groups in the presence of base, forming new compounds.

Formula: C₁₁H₉NO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 187.19 g/mol

Ref: 3D-FP129805