CymitQuimica logo

CAS 78541-81-8

:

(4aR,10bS)-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]quinoline-7,8-diol

Description:
The chemical substance known as (4aR,10bS)-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]quinoline-7,8-diol, with the CAS number 78541-81-8, is a bicyclic compound characterized by its complex polycyclic structure. It features a quinoline core, which is a fused ring system comprising a benzene ring and a pyridine ring. The specific stereochemistry indicated by the (4aR,10bS) configuration suggests the presence of chiral centers, which can influence the compound's biological activity and interactions. This substance is known for its potential pharmacological properties, particularly in medicinal chemistry, where it may exhibit various biological activities, including antioxidant or anti-inflammatory effects. The presence of hydroxyl groups at the 7 and 8 positions contributes to its reactivity and solubility in polar solvents. Overall, this compound's unique structural features and stereochemistry make it a subject of interest in research related to drug development and organic synthesis.
Formula:C13H17NO2
InChI:InChI=1/C13H17NO2/c15-12-6-4-8-9-2-1-7-14-11(9)5-3-10(8)13(12)16/h4,6,9,11,14-16H,1-3,5,7H2/t9-,11+/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.