CAS 78541-97-6
:Piquindone
Description:
Piquindone, with the CAS number 78541-97-6, is a chemical compound that belongs to the class of benzothiazole derivatives. It is primarily recognized for its pharmacological properties, particularly as an anti-inflammatory and analgesic agent. Piquindone exhibits a unique molecular structure that contributes to its biological activity, including the ability to modulate various biochemical pathways. The compound is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which can influence its bioavailability and therapeutic efficacy. Additionally, Piquindone has been studied for its potential applications in treating conditions such as pain and inflammation, although its use may be subject to regulatory scrutiny depending on the jurisdiction. As with many chemical substances, safety data and handling precautions are essential, as Piquindone may pose certain health risks if not managed properly. Overall, its distinct properties make it a subject of interest in medicinal chemistry and pharmacology.
Formula:C15H22N2O
InChI:InChI=1/C15H22N2O/c1-4-11-9(2)16-13-7-10-5-6-17(3)8-12(10)15(18)14(11)13/h10,12,16H,4-8H2,1-3H3/t10-,12+/s2
InChI key:InChIKey=PVZMYDPRVUCJKV-XWJGPBAUNA-N
SMILES:C(C)C=1C2=C(C[C@]3([C@](C2=O)(CN(C)CC3)[H])[H])NC1C
Synonyms:- (4aS,8aS)-3-Ethyl-2,6-dimethyl-1,4a,5,6,7,8,8a,9-octahydro-4H-pyrrolo[2,3-g]isoquinolin-4-one
- (±)-trans-3-Ethyl-1,4a,5,6,7,8,8a,9-octahydro-2,6-dimethyl-4H-pyrrolo[2,3-g]isoquinolin-4-one
- 4H-Pyrrolo[2,3-g]isoquinolin-4-one, 3-ethyl-1,4a,5,6,7,8,8a,9-octahydro-2,6-dimethyl-, (4aR,8aR)-rel-
- 4H-Pyrrolo[2,3-g]isoquinolin-4-one, 3-ethyl-1,4a,5,6,7,8,8a,9-octahydro-2,6-dimethyl-, trans-
- 4H-pyrrolo[2,3-g]isoquinolin-4-one, 3-ethyl-1,4a,5,6,7,8,8a,9-octahydro-2,6-dimethyl-, (4aS,8aS)-
- 78541-97-6
- Ro 22-1319
- rel-(4aR,8aR)-3-Ethyl-1,4a,5,6,7,8,8a,9-octahydro-2,6-dimethyl-4H-pyrrolo[2,3-g]isoquinolin-4-one
- Piquindone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Piquindone
CAS:<p>Piquindone is a medicinal compound that has shown promising anticancer properties in human tumor cells. It acts as an inhibitor of protein kinases, which are enzymes that regulate cell growth and division. Piquindone is an analog of a natural product found in Chinese urine and has been studied for its ability to induce apoptosis, or programmed cell death, in cancer cells. This compound has shown potent activity against various types of cancer cells and may have potential as a therapeutic agent for the treatment of cancer. Its mechanism of action involves the inhibition of specific kinases involved in cancer cell proliferation and survival. Piquindone is being investigated further for its potential as a cancer cell inhibitor.</p>Formula:C15H22N2OPurity:Min. 95%Molecular weight:246.35 g/mol
