CymitQuimica logo

CAS 78542-60-6

:

(2S,5R)-N,N-bis(2-chloroethyl)-5-fluoro-1,3,2-oxazaphosphinan-2-amine 2-oxide

Description:
The chemical substance known as "(2S,5R)-N,N-bis(2-chloroethyl)-5-fluoro-1,3,2-oxazaphosphinan-2-amine 2-oxide," with the CAS number 78542-60-6, is a member of the oxazaphosphorine class of compounds. This compound features a phosphorous atom integrated into a cyclic structure that includes both nitrogen and oxygen, contributing to its unique reactivity and properties. The presence of the chloroethyl groups suggests potential for alkylation reactions, which can be significant in medicinal chemistry, particularly in the development of antitumor agents. The fluorine atom may enhance the compound's biological activity and lipophilicity, influencing its pharmacokinetic properties. Additionally, the stereochemistry indicated by the (2S,5R) configuration suggests specific spatial arrangements that can affect the compound's interaction with biological targets. Overall, this compound's characteristics make it of interest in pharmaceutical research, particularly in the context of developing targeted therapies. However, detailed studies on its toxicity, stability, and efficacy are essential for understanding its potential applications.
Formula:C7H14Cl2FN2O2P
InChI:InChI=1/C7H14Cl2FN2O2P/c8-1-3-12(4-2-9)15(13)11-5-7(10)6-14-15/h7H,1-6H2,(H,11,13)/t7-,15+/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.