CAS 78544-76-0
:1-(phosphonooxy)cyclopropanecarboxylic acid
Description:
1-(Phosphonooxy)cyclopropanecarboxylic acid, with the CAS number 78544-76-0, is a chemical compound characterized by its unique structure that includes a cyclopropane ring and a phosphonooxy functional group. This compound is typically classified as an organophosphorus compound, which often exhibits biological activity, particularly in the context of agricultural chemistry and potential herbicidal properties. The presence of the phosphono group suggests that it may interact with biological systems, potentially influencing metabolic pathways. Additionally, the cyclopropane moiety can impart strain and reactivity, making it an interesting target for synthetic and medicinal chemistry. The compound is likely to be soluble in polar solvents due to the presence of carboxylic acid functionality, which can also participate in hydrogen bonding. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, 1-(phosphonooxy)cyclopropanecarboxylic acid represents a significant compound in the study of organophosphorus chemistry.
Formula:C4H7O6P
InChI:InChI=1/C4H7O6P/c5-3(6)4(1-2-4)10-11(7,8)9/h1-2H2,(H,5,6)(H2,7,8,9)
SMILES:C1CC1(C(=O)O)OP(=O)(O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.