
CAS 78551-64-1
:1-Methyl-4-(phenylmethyl)-2-piperazinone
Description:
1-Methyl-4-(phenylmethyl)-2-piperazinone, identified by its CAS number 78551-64-1, is a chemical compound that belongs to the piperazine class of compounds. It features a piperazinone core, which is a six-membered heterocyclic ring containing two nitrogen atoms. The presence of a methyl group at the 1-position and a phenylmethyl group at the 4-position contributes to its unique properties. This compound is typically characterized by its moderate polarity, which influences its solubility in various organic solvents. It may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. The structure allows for potential interactions with biological targets, which could lead to various therapeutic applications. Additionally, its stability and reactivity can be influenced by the substituents on the piperazine ring. Overall, 1-Methyl-4-(phenylmethyl)-2-piperazinone is a compound of interest for further research in drug development and chemical synthesis.
Formula:C12H16N2O
InChI:InChI=1S/C12H16N2O/c1-13-7-8-14(10-12(13)15)9-11-5-3-2-4-6-11/h2-6H,7-10H2,1H3
InChI key:InChIKey=FXMLEDDKSZZPLP-UHFFFAOYSA-N
SMILES:C(N1CC(=O)N(C)CC1)C2=CC=CC=C2
Synonyms:- 2-Piperazinone, 1-methyl-4-(phenylmethyl)-
- 1-Methyl-4-(phenylmethyl)-2-piperazinone
- Piperazinone, 1-methyl-4-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.